Table of Contents
Details |
Physical and Chemical Properties |
Synonyms |
2D Structure |
3D Structure |
ADMET Properties |
Targets (proven and/or predicted) |
Plants that contains it |
Cross-Links |
Details
Top
Internal ID | 7e8e8724-678f-446a-bcb2-ad13029f2bd3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-[4-hydroxy-3-methoxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3,7-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-4-one |
SMILES (Canonical) | COC1=C(C(=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | COC1=C(C(=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)OC6C(C(C(C(O6)CO)O)O)O)O |
InChI | InChI=1S/C34H42O23/c1-50-13-2-9(3-14(19(13)39)53-33-28(48)25(45)21(41)16(7-36)55-33)30-31(57-34-29(49)26(46)22(42)17(8-37)56-34)23(43)18-11(38)4-10(5-12(18)52-30)51-32-27(47)24(44)20(40)15(6-35)54-32/h2-5,15-17,20-22,24-29,32-42,44-49H,6-8H2,1H3 |
InChI Key | POYUZVAGWZVXKD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Physical and Chemical Properties
Top
Molecular Formula | C34H42O23 |
Molecular Weight | 818.70 g/mol |
Exact Mass | 818.21168758 g/mol |
Topological Polar Surface Area (TPSA) | 374.00 Ų |
XlogP | -3.30 |
Atomic LogP (AlogP) | -5.58 |
H-Bond Acceptor | 23 |
H-Bond Donor | 14 |
Rotatable Bonds | 11 |
Synonyms
Top
There are no found synonyms.
2D Structure
Top
3D Structure
Top
ADMET Properties (via admetSAR 2)
Top
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5457 | 54.57% |
Caco-2 | - | 0.9037 | 90.37% |
Blood Brain Barrier | - | 0.8250 | 82.50% |
Human oral bioavailability | - | 0.6429 | 64.29% |
Subcellular localzation | Mitochondria | 0.5961 | 59.61% |
OATP2B1 inhibitior | - | 0.7164 | 71.64% |
OATP1B1 inhibitior | + | 0.8995 | 89.95% |
OATP1B3 inhibitior | + | 0.9786 | 97.86% |
MATE1 inhibitior | - | 0.8400 | 84.00% |
OCT2 inhibitior | - | 0.8250 | 82.50% |
BSEP inhibitior | + | 0.7770 | 77.70% |
P-glycoprotein inhibitior | + | 0.6116 | 61.16% |
P-glycoprotein substrate | - | 0.6124 | 61.24% |
CYP3A4 substrate | + | 0.6230 | 62.30% |
CYP2C9 substrate | - | 0.8485 | 84.85% |
CYP2D6 substrate | - | 0.8501 | 85.01% |
CYP3A4 inhibition | - | 0.9437 | 94.37% |
CYP2C9 inhibition | - | 0.9060 | 90.60% |
CYP2C19 inhibition | - | 0.8926 | 89.26% |
CYP2D6 inhibition | - | 0.9515 | 95.15% |
CYP1A2 inhibition | - | 0.9150 | 91.50% |
CYP2C8 inhibition | + | 0.7285 | 72.85% |
CYP inhibitory promiscuity | - | 0.7142 | 71.42% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6642 | 66.42% |
Eye corrosion | - | 0.9901 | 99.01% |
Eye irritation | - | 0.9049 | 90.49% |
Skin irritation | - | 0.8320 | 83.20% |
Skin corrosion | - | 0.9606 | 96.06% |
Ames mutagenesis | + | 0.5536 | 55.36% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7567 | 75.67% |
Micronuclear | + | 0.6533 | 65.33% |
Hepatotoxicity | - | 0.7198 | 71.98% |
skin sensitisation | - | 0.9324 | 93.24% |
Respiratory toxicity | + | 0.5667 | 56.67% |
Reproductive toxicity | + | 0.7444 | 74.44% |
Mitochondrial toxicity | - | 0.5000 | 50.00% |
Nephrotoxicity | - | 0.7643 | 76.43% |
Acute Oral Toxicity (c) | III | 0.6678 | 66.78% |
Estrogen receptor binding | + | 0.8325 | 83.25% |
Androgen receptor binding | + | 0.5776 | 57.76% |
Thyroid receptor binding | - | 0.5075 | 50.75% |
Glucocorticoid receptor binding | - | 0.4833 | 48.33% |
Aromatase binding | + | 0.5368 | 53.68% |
PPAR gamma | + | 0.7237 | 72.37% |
Honey bee toxicity | - | 0.7496 | 74.96% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | - | 0.6249 | 62.49% |
Fish aquatic toxicity | + | 0.6698 | 66.98% |
Targets
Top
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.64% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.71% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.82% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.36% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.55% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.60% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.13% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.02% | 95.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.72% | 96.21% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.18% | 95.64% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.69% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.53% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.76% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.59% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.35% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.17% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.74% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.49% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.34% | 97.36% |
CHEMBL220 | P22303 | Acetylcholinesterase | 80.30% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.22% | 95.89% |
Plants that contains it
Top
Below are displayed all the plants proven (via scientific papers) to contain this compound!
To see more specific details click the taxa you are interested in.
Medicago truncatula
Cross-Links
Top
PubChem | 74978322 |
LOTUS | LTS0049691 |
wikiData | Q105212768 |